C15H17N — CID 144631857
N-[(1E,4Z)-2-ethenyl-1-phenylhexa-1,4-dienyl]methanimine (PubChem CID 144631857) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is N-[(1E,4Z)-2-ethenyl-1-phenylhexa-1,4-dienyl]methanimine.
| Compound Name | N-[(1E,4Z)-2-ethenyl-1-phenylhexa-1,4-dienyl]methanimine |
|---|---|
| PubChem CID | 144631857 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-[(1E,4Z)-2-ethenyl-1-phenylhexa-1,4-dienyl]methanimine |
| SMILES | C=C/C(C/C=C\C)=C(/N=C)c1ccccc1 |
| InChI | InChI=1S/C15H17N/c1-4-6-10-13(5-2)15(16-3)14-11-8-7-9-12-14/h4-9,11-12H,2-3,10H2,1H3/b6-4-,15-13- |
| InChIKey | HRLTZDTURIUVTG-OOBBZECWSA-N |
| XLogP | 4.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|