C21H29N3 — CID 145436814
ethane;N'-[(Z)-2-(methylideneamino)-1,2-diphenylethenyl]ethanimidamide (PubChem CID 145436814) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is ethane;N'-[(Z)-2-(methylideneamino)-1,2-diphenylethenyl]ethanimidamide.
| Compound Name | ethane;N'-[(Z)-2-(methylideneamino)-1,2-diphenylethenyl]ethanimidamide |
|---|---|
| PubChem CID | 145436814 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | ethane;N'-[(Z)-2-(methylideneamino)-1,2-diphenylethenyl]ethanimidamide |
| SMILES | C=N/C(=C(\N=C(/C)N)c1ccccc1)c1ccccc1.CC.CC |
| InChI | InChI=1S/C17H17N3.2C2H6/c1-13(18)20-17(15-11-7-4-8-12-15)16(19-2)14-9-5-3-6-10-14;2*1-2/h3-12H,2H2,1H3,(H2,18,20);2*1-2H3/b17-16-;; |
| InChIKey | JGPHSVZVCWRBME-LSSNYKSTSA-N |
| XLogP | 5.64 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|