C24H31N3O — CID 134217388
N-(4-hydroxybutyl)-N'-[(Z)-2-(methylideneamino)-1,2-diphenylethenyl]-N-propan-2-ylethanimidamide (PubChem CID 134217388) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-N'-[(Z)-2-(methylideneamino)-1,2-diphenylethenyl]-N-propan-2-ylethanimidamide.
| Compound Name | N-(4-hydroxybutyl)-N'-[(Z)-2-(methylideneamino)-1,2-diphenylethenyl]-N-propan-2-ylethanimidamide |
|---|---|
| PubChem CID | 134217388 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-(4-hydroxybutyl)-N'-[(Z)-2-(methylideneamino)-1,2-diphenylethenyl]-N-propan-2-ylethanimidamide |
| SMILES | C=N/C(=C(\N=C(/C)N(CCCCO)C(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O/c1-19(2)27(17-11-12-18-28)20(3)26-24(22-15-9-6-10-16-22)23(25-4)21-13-7-5-8-14-21/h5-10,13-16,19,28H,4,11-12,17-18H2,1-3H3/b24-23-,26-20+ |
| InChIKey | NPVSYMFSLNYMNR-LMQNXGCNSA-N |
| XLogP | 5.11 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|