C27H36N2O — CID 145260758
N'-[(E)-1,2-diphenylprop-1-enyl]-N-(4-hydroxybutyl)-3-methyl-N-propan-2-ylbut-2-enimidamide (PubChem CID 145260758) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is N'-[(E)-1,2-diphenylprop-1-enyl]-N-(4-hydroxybutyl)-3-methyl-N-propan-2-ylbut-2-enimidamide.
| Compound Name | N'-[(E)-1,2-diphenylprop-1-enyl]-N-(4-hydroxybutyl)-3-methyl-N-propan-2-ylbut-2-enimidamide |
|---|---|
| PubChem CID | 145260758 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | N'-[(E)-1,2-diphenylprop-1-enyl]-N-(4-hydroxybutyl)-3-methyl-N-propan-2-ylbut-2-enimidamide |
| SMILES | CC(C)=C/C(=N\C(=C(/C)c1ccccc1)c1ccccc1)N(CCCCO)C(C)C |
| InChI | InChI=1S/C27H36N2O/c1-21(2)20-26(29(22(3)4)18-12-13-19-30)28-27(25-16-10-7-11-17-25)23(5)24-14-8-6-9-15-24/h6-11,14-17,20,22,30H,12-13,18-19H2,1-5H3/b27-23+,28-26+ |
| InChIKey | NKXUKIFEKYGJQT-GKDSKZQZSA-N |
| XLogP | 6.42 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|