About ethane;molecular hydrogen;1-phenylethenamine
ethane;molecular hydrogen;1-phenylethenamine (PubChem CID 156816097) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is ethane;molecular hydrogen;1-phenylethenamine.
Molecular Properties
| Compound Name | ethane;molecular hydrogen;1-phenylethenamine |
| PubChem CID | 156816097 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | ethane;molecular hydrogen;1-phenylethenamine |
| SMILES | C=C(N)c1ccccc1.CC.[H][H] |
| InChI | InChI=1S/C8H9N.C2H6.H2/c1-7(9)8-5-3-2-4-6-8;1-2;/h2-6H,1,9H2;1-2H3;1H |
| InChIKey | UPKXCZPAFBCZFF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;molecular hydrogen;1-phenylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;molecular hydrogen;1-phenylethenamine?
The IUPAC name of ethane;molecular hydrogen;1-phenylethenamine (CID 156816097) is ethane;molecular hydrogen;1-phenylethenamine.
What is the SMILES notation for ethane;molecular hydrogen;1-phenylethenamine?
The canonical SMILES for ethane;molecular hydrogen;1-phenylethenamine is C=C(N)c1ccccc1.CC.[H][H].
What is the InChIKey of ethane;molecular hydrogen;1-phenylethenamine?
The InChIKey is UPKXCZPAFBCZFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.C2H6.H2/c1-7(9)8-5-3-2-4-6-8;1-2;/h2-6H,1,9H2;1-2H3;1H.
What are the key properties of ethane;molecular hydrogen;1-phenylethenamine?
ethane;molecular hydrogen;1-phenylethenamine has a molecular weight of 151.25 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;molecular hydrogen;1-phenylethenamine is sourced from PubChem (CID 156816097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).