C13H18N2 — CID 156522918
(E)-2,3-dimethyl-N-(methylideneamino)-1-phenylbut-1-en-1-amine (PubChem CID 156522918) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (E)-2,3-dimethyl-N-(methylideneamino)-1-phenylbut-1-en-1-amine.
| Compound Name | (E)-2,3-dimethyl-N-(methylideneamino)-1-phenylbut-1-en-1-amine |
|---|---|
| PubChem CID | 156522918 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (E)-2,3-dimethyl-N-(methylideneamino)-1-phenylbut-1-en-1-amine |
| SMILES | C=NN/C(=C(\C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H18N2/c1-10(2)11(3)13(15-14-4)12-8-6-5-7-9-12/h5-10,15H,4H2,1-3H3/b13-11+ |
| InChIKey | MZIUWDGEYWHXAA-ACCUITESSA-N |
| XLogP | 3.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|