C15H15N3 — CID 11128320
N'-(benzhydrylideneamino)ethanimidamide (PubChem CID 11128320) has the molecular formula C15H15N3 and a molecular weight of 237.31 g/mol. Its IUPAC name is N'-(benzhydrylideneamino)ethanimidamide.
| Compound Name | N'-(benzhydrylideneamino)ethanimidamide |
|---|---|
| PubChem CID | 11128320 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N'-(benzhydrylideneamino)ethanimidamide |
| SMILES | C/C(N)=N/N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3/c1-12(16)17-18-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,1H3,(H2,16,17) |
| InChIKey | FPHCVQTYECSTRW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|