C23H22N2 — CID 4649996
N-(benzhydrylideneamino)-1-(3,4-dimethylphenyl)ethanimine (PubChem CID 4649996) has the molecular formula C23H22N2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-(benzhydrylideneamino)-1-(3,4-dimethylphenyl)ethanimine.
| Compound Name | N-(benzhydrylideneamino)-1-(3,4-dimethylphenyl)ethanimine |
|---|---|
| PubChem CID | 4649996 |
| Molecular Formula | C23H22N2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-(benzhydrylideneamino)-1-(3,4-dimethylphenyl)ethanimine |
| SMILES | CC(=NN=C(c1ccccc1)c1ccccc1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C23H22N2/c1-17-14-15-22(16-18(17)2)19(3)24-25-23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-16H,1-3H3 |
| InChIKey | KVIATUMOSPUQNC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|