C11H15NO — CID 21345733
(E)-1-(3,4-dimethylphenyl)-N-methoxyethanimine (PubChem CID 21345733) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (E)-1-(3,4-dimethylphenyl)-N-methoxyethanimine.
| Compound Name | (E)-1-(3,4-dimethylphenyl)-N-methoxyethanimine |
|---|---|
| PubChem CID | 21345733 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (E)-1-(3,4-dimethylphenyl)-N-methoxyethanimine |
| SMILES | CO/N=C(\C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H15NO/c1-8-5-6-11(7-9(8)2)10(3)12-13-4/h5-7H,1-4H3/b12-10+ |
| InChIKey | ODTOTSAPLUNCLJ-ZRDIBKRKSA-N |
| XLogP | 2.67 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|