C9H9N3O2 — CID 72609414
1-(2,1,3-benzoxadiazol-5-yl)-N-methoxyethanimine (PubChem CID 72609414) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1-(2,1,3-benzoxadiazol-5-yl)-N-methoxyethanimine.
| Compound Name | 1-(2,1,3-benzoxadiazol-5-yl)-N-methoxyethanimine |
|---|---|
| PubChem CID | 72609414 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 1-(2,1,3-benzoxadiazol-5-yl)-N-methoxyethanimine |
| SMILES | CON=C(C)c1ccc2nonc2c1 |
| InChI | InChI=1S/C9H9N3O2/c1-6(10-13-2)7-3-4-8-9(5-7)12-14-11-8/h3-5H,1-2H3 |
| InChIKey | ICOKTGBYFMLVAV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 60.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|