C18H20N2O2 — CID 137059978
(NE)-N-[(2E)-1,2-bis(3,4-dimethylphenyl)-2-hydroxyiminoethylidene]hydroxylamine (PubChem CID 137059978) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (NE)-N-[(2E)-1,2-bis(3,4-dimethylphenyl)-2-hydroxyiminoethylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2E)-1,2-bis(3,4-dimethylphenyl)-2-hydroxyiminoethylidene]hydroxylamine |
|---|---|
| PubChem CID | 137059978 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (NE)-N-[(2E)-1,2-bis(3,4-dimethylphenyl)-2-hydroxyiminoethylidene]hydroxylamine |
| SMILES | Cc1ccc(C(=N\O)/C(=N/O)c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C18H20N2O2/c1-11-5-7-15(9-13(11)3)17(19-21)18(20-22)16-8-6-12(2)14(4)10-16/h5-10,21-22H,1-4H3/b19-17+,20-18+ |
| InChIKey | AQMKTQAJNBWYCF-XPWSMXQVSA-N |
| XLogP | 3.98 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|