C11H13NO — CID 69495371
2-(3,4-dimethylphenyl)prop-2-enamide (PubChem CID 69495371) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)prop-2-enamide.
| Compound Name | 2-(3,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 69495371 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-(3,4-dimethylphenyl)prop-2-enamide |
| SMILES | C=C(C(N)=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H13NO/c1-7-4-5-10(6-8(7)2)9(3)11(12)13/h4-6H,3H2,1-2H3,(H2,12,13) |
| InChIKey | QBHXKJPZNSXBIJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|