C19H24ClNO2 — CID 159802984
3,4-dimethylbenzamide;3,4-dimethylbenzoyl chloride;methane (PubChem CID 159802984) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is 3,4-dimethylbenzamide;3,4-dimethylbenzoyl chloride;methane.
| Compound Name | 3,4-dimethylbenzamide;3,4-dimethylbenzoyl chloride;methane |
|---|---|
| PubChem CID | 159802984 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 3,4-dimethylbenzamide;3,4-dimethylbenzoyl chloride;methane |
| SMILES | C.Cc1ccc(C(=O)Cl)cc1C.Cc1ccc(C(N)=O)cc1C |
| InChI | InChI=1S/C9H9ClO.C9H11NO.CH4/c2*1-6-3-4-8(9(10)11)5-7(6)2;/h3-5H,1-2H3;3-5H,1-2H3,(H2,10,11);1H4 |
| InChIKey | NKAMAUBVBLTDTD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|