C10H15N3O — CID 154522714
N-(diaminomethyl)-3,4-dimethylbenzamide (PubChem CID 154522714) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(diaminomethyl)-3,4-dimethylbenzamide.
| Compound Name | N-(diaminomethyl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 154522714 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-(diaminomethyl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(N)N)cc1C |
| InChI | InChI=1S/C10H15N3O/c1-6-3-4-8(5-7(6)2)9(14)13-10(11)12/h3-5,10H,11-12H2,1-2H3,(H,13,14) |
| InChIKey | LIZNVFKQZMKMHF-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|