C18H21NO — CID 94195982
3,4-dimethyl-N-[(1R)-1-(4-methylphenyl)ethyl]benzamide (PubChem CID 94195982) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(1R)-1-(4-methylphenyl)ethyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[(1R)-1-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 94195982 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 3,4-dimethyl-N-[(1R)-1-(4-methylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H21NO/c1-12-5-8-16(9-6-12)15(4)19-18(20)17-10-7-13(2)14(3)11-17/h5-11,15H,1-4H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | YUTNFRSIGVQEQK-OAHLLOKOSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |