About triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane
triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane (PubChem CID 102471462) has the molecular formula C18H28Ge
and a molecular weight of 317.03 g/mol. Its IUPAC name is triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane.
Molecular Properties
| Compound Name | triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane |
| PubChem CID | 102471462 |
| Molecular Formula | C18H28Ge |
| Molecular Weight | 317.03 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane |
| SMILES | C/C=C/C/C(=C\[Ge](CC)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C18H28Ge/c1-5-9-13-18(17-14-11-10-12-15-17)16-19(6-2,7-3)8-4/h5,9-12,14-16H,6-8,13H2,1-4H3/b9-5+,18-16+ |
| InChIKey | HDRZIFVOBPIRSY-HQKQHSPBSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.03 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane?
The IUPAC name of triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane (CID 102471462) is triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane.
What is the SMILES notation for triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane?
The canonical SMILES for triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane is C/C=C/C/C(=C\[Ge](CC)(CC)CC)c1ccccc1.
What is the InChIKey of triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane?
The InChIKey is HDRZIFVOBPIRSY-HQKQHSPBSA-N. The full InChI is InChI=1S/C18H28Ge/c1-5-9-13-18(17-14-11-10-12-15-17)16-19(6-2,7-3)8-4/h5,9-12,14-16H,6-8,13H2,1-4H3/b9-5+,18-16+.
What are the key properties of triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane?
triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane has a molecular weight of 317.03 g/mol, XLogP of 6.08, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane is sourced from PubChem (CID 102471462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).