C18H28Ge — CID 102471462
triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane (PubChem CID 102471462) has the molecular formula C18H28Ge and a molecular weight of 317.03 g/mol. Its IUPAC name is triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane.
| Compound Name | triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane |
|---|---|
| PubChem CID | 102471462 |
| Molecular Formula | C18H28Ge |
| Molecular Weight | 317.03 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | triethyl-[(1E,4E)-2-phenylhexa-1,4-dienyl]germane |
| SMILES | C/C=C/C/C(=C\[Ge](CC)(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C18H28Ge/c1-5-9-13-18(17-14-11-10-12-15-17)16-19(6-2,7-3)8-4/h5,9-12,14-16H,6-8,13H2,1-4H3/b9-5+,18-16+ |
| InChIKey | HDRZIFVOBPIRSY-HQKQHSPBSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.03 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|