C13H15F — CID 155725923
[(3E)-5-fluorohepta-3,5-dien-3-yl]benzene (PubChem CID 155725923) has the molecular formula C13H15F and a molecular weight of 190.26 g/mol. Its IUPAC name is [(3E)-5-fluorohepta-3,5-dien-3-yl]benzene.
| Compound Name | [(3E)-5-fluorohepta-3,5-dien-3-yl]benzene |
|---|---|
| PubChem CID | 155725923 |
| Molecular Formula | C13H15F |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | [(3E)-5-fluorohepta-3,5-dien-3-yl]benzene |
| SMILES | CC=C(F)/C=C(\CC)c1ccccc1 |
| InChI | InChI=1S/C13H15F/c1-3-11(10-13(14)4-2)12-8-6-5-7-9-12/h4-10H,3H2,1-2H3/b11-10+,13-4? |
| InChIKey | HXTDCFFEKWEYMW-KKSIXNQLSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|