C14H18 — CID 123274191
5-methylhepta-3,5-dien-3-ylbenzene (PubChem CID 123274191) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 5-methylhepta-3,5-dien-3-ylbenzene.
| Compound Name | 5-methylhepta-3,5-dien-3-ylbenzene |
|---|---|
| PubChem CID | 123274191 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 5-methylhepta-3,5-dien-3-ylbenzene |
| SMILES | CC=C(C)C=C(CC)c1ccccc1 |
| InChI | InChI=1S/C14H18/c1-4-12(3)11-13(5-2)14-9-7-6-8-10-14/h4,6-11H,5H2,1-3H3 |
| InChIKey | ZDIHEYKVWZGVKG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|