C38H36N2 — CID 143318076
4-[(1E,3E)-2-methyl-4-[4-(N-methylanilino)phenyl]hexa-1,3-dienyl]-N,N-diphenylaniline (PubChem CID 143318076) has the molecular formula C38H36N2 and a molecular weight of 520.72 g/mol. Its IUPAC name is 4-[(1E,3E)-2-methyl-4-[4-(N-methylanilino)phenyl]hexa-1,3-dienyl]-N,N-diphenylaniline.
| Compound Name | 4-[(1E,3E)-2-methyl-4-[4-(N-methylanilino)phenyl]hexa-1,3-dienyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 143318076 |
| Molecular Formula | C38H36N2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | 4-[(1E,3E)-2-methyl-4-[4-(N-methylanilino)phenyl]hexa-1,3-dienyl]-N,N-diphenylaniline |
| SMILES | CC/C(=C\C(C)=C\c1ccc(N(c2ccccc2)c2ccccc2)cc1)c1ccc(N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H36N2/c1-4-32(33-22-26-35(27-23-33)39(3)34-14-8-5-9-15-34)29-30(2)28-31-20-24-38(25-21-31)40(36-16-10-6-11-17-36)37-18-12-7-13-19-37/h5-29H,4H2,1-3H3/b30-28+,32-29+ |
| InChIKey | XBMDRLOTIRBKBL-HTWAGONQSA-N |
| XLogP | 10.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|