C25H42Sn — CID 177456786
tributyl-[(1E,4E)-2-methyl-1-phenylhexa-1,4-dienyl]stannane (PubChem CID 177456786) has the molecular formula C25H42Sn and a molecular weight of 461.32 g/mol. Its IUPAC name is tributyl-[(1E,4E)-2-methyl-1-phenylhexa-1,4-dienyl]stannane.
| Compound Name | tributyl-[(1E,4E)-2-methyl-1-phenylhexa-1,4-dienyl]stannane |
|---|---|
| PubChem CID | 177456786 |
| Molecular Formula | C25H42Sn |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | tributyl-[(1E,4E)-2-methyl-1-phenylhexa-1,4-dienyl]stannane |
| SMILES | C/C=C/C/C(C)=C(\c1ccccc1)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C13H15.3C4H9.Sn/c1-3-4-8-12(2)11-13-9-6-5-7-10-13;3*1-3-4-2;/h3-7,9-10H,8H2,1-2H3;3*1,3-4H2,2H3;/b4-3+,12-11?;;;; |
| InChIKey | DZNUSGDPLKMJLL-ZBDITARFSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|