C34H42Sn — CID 170459763
tributyl-[(E)-1,2-dinaphthalen-2-ylethenyl]stannane (PubChem CID 170459763) has the molecular formula C34H42Sn and a molecular weight of 569.42 g/mol. Its IUPAC name is tributyl-[(E)-1,2-dinaphthalen-2-ylethenyl]stannane.
| Compound Name | tributyl-[(E)-1,2-dinaphthalen-2-ylethenyl]stannane |
|---|---|
| PubChem CID | 170459763 |
| Molecular Formula | C34H42Sn |
| Molecular Weight | 569.42 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | tributyl-[(E)-1,2-dinaphthalen-2-ylethenyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/c1ccc2ccccc2c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H15.3C4H9.Sn/c1-3-7-21-15-17(11-13-19(21)5-1)9-10-18-12-14-20-6-2-4-8-22(20)16-18;3*1-3-4-2;/h1-9,11-16H;3*1,3-4H2,2H3; |
| InChIKey | DSWCXDAKVQGWFR-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.42 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|