C30H48N2Sn — CID 171661574
4-[(E)-2-[4-(dimethylamino)phenyl]-2-tributylstannylethenyl]-N,N-dimethylaniline (PubChem CID 171661574) has the molecular formula C30H48N2Sn and a molecular weight of 555.44 g/mol. Its IUPAC name is 4-[(E)-2-[4-(dimethylamino)phenyl]-2-tributylstannylethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[4-(dimethylamino)phenyl]-2-tributylstannylethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 171661574 |
| Molecular Formula | C30H48N2Sn |
| Molecular Weight | 555.44 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 4-[(E)-2-[4-(dimethylamino)phenyl]-2-tributylstannylethenyl]-N,N-dimethylaniline |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H21N2.3C4H9.Sn/c1-19(2)17-11-7-15(8-12-17)5-6-16-9-13-18(14-10-16)20(3)4;3*1-3-4-2;/h5,7-14H,1-4H3;3*1,3-4H2,2H3; |
| InChIKey | OEYWJGGQMBUSLC-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.44 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|