C12H16ClN — CID 79322317
4-(3-chloro-2-methylprop-1-enyl)-N,N-dimethylaniline (PubChem CID 79322317) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 4-(3-chloro-2-methylprop-1-enyl)-N,N-dimethylaniline.
| Compound Name | 4-(3-chloro-2-methylprop-1-enyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 79322317 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4-(3-chloro-2-methylprop-1-enyl)-N,N-dimethylaniline |
| SMILES | CC(=Cc1ccc(N(C)C)cc1)CCl |
| InChI | InChI=1S/C12H16ClN/c1-10(9-13)8-11-4-6-12(7-5-11)14(2)3/h4-8H,9H2,1-3H3 |
| InChIKey | LCWIVFJUSVZTDY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|