C14H11F6NO2 — CID 132916497
3-[[4-(dimethylamino)phenyl]methylidene]-1,1,1,5,5,5-hexafluoropentane-2,4-dione (PubChem CID 132916497) has the molecular formula C14H11F6NO2 and a molecular weight of 339.24 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]methylidene]-1,1,1,5,5,5-hexafluoropentane-2,4-dione.
| Compound Name | 3-[[4-(dimethylamino)phenyl]methylidene]-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
|---|---|
| PubChem CID | 132916497 |
| Molecular Formula | C14H11F6NO2 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]methylidene]-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
| SMILES | CN(C)c1ccc(C=C(C(=O)C(F)(F)F)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F6NO2/c1-21(2)9-5-3-8(4-6-9)7-10(11(22)13(15,16)17)12(23)14(18,19)20/h3-7H,1-2H3 |
| InChIKey | YGHNHNJMVMMCHK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|