C11H13F3N2O — CID 91720800
N-[4-(dimethylamino)phenyl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 91720800) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 91720800 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(C)c1ccc(N(C)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O/c1-15(2)8-4-6-9(7-5-8)16(3)10(17)11(12,13)14/h4-7H,1-3H3 |
| InChIKey | CWJCBWZZZUEJTC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|