C27H32N2O5 — CID 139627313
diethyl 2,4-bis[[4-(dimethylamino)phenyl]methylidene]-3-oxopentanedioate (PubChem CID 139627313) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is diethyl 2,4-bis[[4-(dimethylamino)phenyl]methylidene]-3-oxopentanedioate.
| Compound Name | diethyl 2,4-bis[[4-(dimethylamino)phenyl]methylidene]-3-oxopentanedioate |
|---|---|
| PubChem CID | 139627313 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | diethyl 2,4-bis[[4-(dimethylamino)phenyl]methylidene]-3-oxopentanedioate |
| SMILES | CCOC(=O)C(=Cc1ccc(N(C)C)cc1)C(=O)C(=Cc1ccc(N(C)C)cc1)C(=O)OCC |
| InChI | InChI=1S/C27H32N2O5/c1-7-33-26(31)23(17-19-9-13-21(14-10-19)28(3)4)25(30)24(27(32)34-8-2)18-20-11-15-22(16-12-20)29(5)6/h9-18H,7-8H2,1-6H3 |
| InChIKey | IFGVPKKBDQKRBG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|