C33H44N2O5 — CID 139645615
dipropan-2-yl 2,4-bis[[4-(diethylamino)phenyl]methylidene]-3-oxopentanedioate (PubChem CID 139645615) has the molecular formula C33H44N2O5 and a molecular weight of 548.72 g/mol. Its IUPAC name is dipropan-2-yl 2,4-bis[[4-(diethylamino)phenyl]methylidene]-3-oxopentanedioate.
| Compound Name | dipropan-2-yl 2,4-bis[[4-(diethylamino)phenyl]methylidene]-3-oxopentanedioate |
|---|---|
| PubChem CID | 139645615 |
| Molecular Formula | C33H44N2O5 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | dipropan-2-yl 2,4-bis[[4-(diethylamino)phenyl]methylidene]-3-oxopentanedioate |
| SMILES | CCN(CC)c1ccc(C=C(C(=O)OC(C)C)C(=O)C(=Cc2ccc(N(CC)CC)cc2)C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C33H44N2O5/c1-9-34(10-2)27-17-13-25(14-18-27)21-29(32(37)39-23(5)6)31(36)30(33(38)40-24(7)8)22-26-15-19-28(20-16-26)35(11-3)12-4/h13-24H,9-12H2,1-8H3 |
| InChIKey | PKCGEQCSVHSKGS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|