C17H19N3O2 — CID 20767600
propan-2-yl 2-[4-(2,2-diisocyanoethenyl)-N-ethylanilino]acetate (PubChem CID 20767600) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is propan-2-yl 2-[4-(2,2-diisocyanoethenyl)-N-ethylanilino]acetate.
| Compound Name | propan-2-yl 2-[4-(2,2-diisocyanoethenyl)-N-ethylanilino]acetate |
|---|---|
| PubChem CID | 20767600 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | propan-2-yl 2-[4-(2,2-diisocyanoethenyl)-N-ethylanilino]acetate |
| SMILES | [C-]#[N+]C(=Cc1ccc(N(CC)CC(=O)OC(C)C)cc1)[N+]#[C-] |
| InChI | InChI=1S/C17H19N3O2/c1-6-20(12-17(21)22-13(2)3)15-9-7-14(8-10-15)11-16(18-4)19-5/h7-11,13H,6,12H2,1-3H3 |
| InChIKey | UQMIBLBKCHSINB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|