C11H8N2 — CID 58090174
1-(2,2-diisocyanoethenyl)-4-methylbenzene (PubChem CID 58090174) has the molecular formula C11H8N2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-(2,2-diisocyanoethenyl)-4-methylbenzene.
| Compound Name | 1-(2,2-diisocyanoethenyl)-4-methylbenzene |
|---|---|
| PubChem CID | 58090174 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1-(2,2-diisocyanoethenyl)-4-methylbenzene |
| SMILES | [C-]#[N+]C(=Cc1ccc(C)cc1)[N+]#[C-] |
| InChI | InChI=1S/C11H8N2/c1-9-4-6-10(7-5-9)8-11(12-2)13-3/h4-8H,1H3 |
| InChIKey | RSFQDCYOLGWMTO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|