C26H27N3O2 — CID 8726729
2-[[4-(dimethylamino)phenyl]methylidene]-N,N'-bis(2-methylphenyl)propanediamide (PubChem CID 8726729) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)phenyl]methylidene]-N,N'-bis(2-methylphenyl)propanediamide.
| Compound Name | 2-[[4-(dimethylamino)phenyl]methylidene]-N,N'-bis(2-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 8726729 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]methylidene]-N,N'-bis(2-methylphenyl)propanediamide |
| SMILES | Cc1ccccc1NC(=O)C(=Cc1ccc(N(C)C)cc1)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C26H27N3O2/c1-18-9-5-7-11-23(18)27-25(30)22(17-20-13-15-21(16-14-20)29(3)4)26(31)28-24-12-8-6-10-19(24)2/h5-17H,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | PZJJFXORKNKWHZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|