C23H23N3O2 — CID 109056881
1-N-[4-(dimethylamino)phenyl]-3-N-(2-methylphenyl)benzene-1,3-dicarboxamide (PubChem CID 109056881) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-N-[4-(dimethylamino)phenyl]-3-N-(2-methylphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[4-(dimethylamino)phenyl]-3-N-(2-methylphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109056881 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-N-[4-(dimethylamino)phenyl]-3-N-(2-methylphenyl)benzene-1,3-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)c1cccc(C(=O)Nc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C23H23N3O2/c1-16-7-4-5-10-21(16)25-23(28)18-9-6-8-17(15-18)22(27)24-19-11-13-20(14-12-19)26(2)3/h4-15H,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | NKPVFZDQWXQZQE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|