C24H20F2N2O2 — CID 9446874
2-[(3,4-difluorophenyl)methylidene]-N,N'-bis(2-methylphenyl)propanediamide (PubChem CID 9446874) has the molecular formula C24H20F2N2O2 and a molecular weight of 406.43 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methylidene]-N,N'-bis(2-methylphenyl)propanediamide.
| Compound Name | 2-[(3,4-difluorophenyl)methylidene]-N,N'-bis(2-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 9446874 |
| Molecular Formula | C24H20F2N2O2 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methylidene]-N,N'-bis(2-methylphenyl)propanediamide |
| SMILES | Cc1ccccc1NC(=O)C(=Cc1ccc(F)c(F)c1)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C24H20F2N2O2/c1-15-7-3-5-9-21(15)27-23(29)18(13-17-11-12-19(25)20(26)14-17)24(30)28-22-10-6-4-8-16(22)2/h3-14H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | WZPOMKCBOSVBSG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|