C22H14F4N2O2 — CID 27131160
2-[(2,6-difluorophenyl)methylidene]-N,N'-bis(2-fluorophenyl)propanediamide (PubChem CID 27131160) has the molecular formula C22H14F4N2O2 and a molecular weight of 414.36 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methylidene]-N,N'-bis(2-fluorophenyl)propanediamide.
| Compound Name | 2-[(2,6-difluorophenyl)methylidene]-N,N'-bis(2-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 27131160 |
| Molecular Formula | C22H14F4N2O2 |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methylidene]-N,N'-bis(2-fluorophenyl)propanediamide |
| SMILES | O=C(Nc1ccccc1F)C(=Cc1c(F)cccc1F)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C22H14F4N2O2/c23-15-8-5-9-16(24)13(15)12-14(21(29)27-19-10-3-1-6-17(19)25)22(30)28-20-11-4-2-7-18(20)26/h1-12H,(H,27,29)(H,28,30) |
| InChIKey | IOWUXYIBXJLSJA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|