C12H9FN4O2 — CID 108520680
N-(2-fluorophenyl)-N'-pyrimidin-2-yloxamide (PubChem CID 108520680) has the molecular formula C12H9FN4O2 and a molecular weight of 260.23 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-pyrimidin-2-yloxamide.
| Compound Name | N-(2-fluorophenyl)-N'-pyrimidin-2-yloxamide |
|---|---|
| PubChem CID | 108520680 |
| Molecular Formula | C12H9FN4O2 |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-(2-fluorophenyl)-N'-pyrimidin-2-yloxamide |
| SMILES | O=C(Nc1ncccn1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C12H9FN4O2/c13-8-4-1-2-5-9(8)16-10(18)11(19)17-12-14-6-3-7-15-12/h1-7H,(H,16,18)(H,14,15,17,19) |
| InChIKey | SKKLTUKPEVJCLJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|