C14H14FN5O2 — CID 75478194
2-[2-(4,6-dimethylpyrimidin-2-yl)hydrazinyl]-N-(2-fluorophenyl)-2-oxoacetamide (PubChem CID 75478194) has the molecular formula C14H14FN5O2 and a molecular weight of 303.30 g/mol. Its IUPAC name is 2-[2-(4,6-dimethylpyrimidin-2-yl)hydrazinyl]-N-(2-fluorophenyl)-2-oxoacetamide.
| Compound Name | 2-[2-(4,6-dimethylpyrimidin-2-yl)hydrazinyl]-N-(2-fluorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 75478194 |
| Molecular Formula | C14H14FN5O2 |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[2-(4,6-dimethylpyrimidin-2-yl)hydrazinyl]-N-(2-fluorophenyl)-2-oxoacetamide |
| SMILES | Cc1cc(C)nc(NNC(=O)C(=O)Nc2ccccc2F)n1 |
| InChI | InChI=1S/C14H14FN5O2/c1-8-7-9(2)17-14(16-8)20-19-13(22)12(21)18-11-6-4-3-5-10(11)15/h3-7H,1-2H3,(H,18,21)(H,19,22)(H,16,17,20) |
| InChIKey | PGANMXLOIBZHAF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|