C14H15FN4O — CID 53016555
1-[2-(dimethylamino)-3-pyridinyl]-3-(2-fluorophenyl)urea (PubChem CID 53016555) has the molecular formula C14H15FN4O and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-pyridinyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[2-(dimethylamino)-3-pyridinyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 53016555 |
| Molecular Formula | C14H15FN4O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-[2-(dimethylamino)-3-pyridinyl]-3-(2-fluorophenyl)urea |
| SMILES | CN(C)c1ncccc1NC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C14H15FN4O/c1-19(2)13-12(8-5-9-16-13)18-14(20)17-11-7-4-3-6-10(11)15/h3-9H,1-2H3,(H2,17,18,20) |
| InChIKey | KPPSOOSDYDBUAX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |