C10H13N3O3 — CID 62230948
3-[[2-(dimethylamino)-3-pyridinyl]amino]-3-oxopropanoic acid (PubChem CID 62230948) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)-3-pyridinyl]amino]-3-oxopropanoic acid.
| Compound Name | 3-[[2-(dimethylamino)-3-pyridinyl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 62230948 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-[[2-(dimethylamino)-3-pyridinyl]amino]-3-oxopropanoic acid |
| SMILES | CN(C)c1ncccc1NC(=O)CC(=O)O |
| InChI | InChI=1S/C10H13N3O3/c1-13(2)10-7(4-3-5-11-10)12-8(14)6-9(15)16/h3-5H,6H2,1-2H3,(H,12,14)(H,15,16) |
| InChIKey | XXRYEQPHDQTZGZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|