C22H14Cl2F2N2O2 — CID 2374084
2-[(2,4-dichlorophenyl)methylidene]-N,N'-bis(2-fluorophenyl)propanediamide (PubChem CID 2374084) has the molecular formula C22H14Cl2F2N2O2 and a molecular weight of 447.27 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylidene]-N,N'-bis(2-fluorophenyl)propanediamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methylidene]-N,N'-bis(2-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 2374084 |
| Molecular Formula | C22H14Cl2F2N2O2 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylidene]-N,N'-bis(2-fluorophenyl)propanediamide |
| SMILES | O=C(Nc1ccccc1F)C(=Cc1ccc(Cl)cc1Cl)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C22H14Cl2F2N2O2/c23-14-10-9-13(16(24)12-14)11-15(21(29)27-19-7-3-1-5-17(19)25)22(30)28-20-8-4-2-6-18(20)26/h1-12H,(H,27,29)(H,28,30) |
| InChIKey | GVLMCNYTUXAODE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|