C23H22N2O2S — CID 9446875
N,N'-bis(2-methylphenyl)-2-[(5-methylthiophen-2-yl)methylidene]propanediamide (PubChem CID 9446875) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is N,N'-bis(2-methylphenyl)-2-[(5-methylthiophen-2-yl)methylidene]propanediamide.
| Compound Name | N,N'-bis(2-methylphenyl)-2-[(5-methylthiophen-2-yl)methylidene]propanediamide |
|---|---|
| PubChem CID | 9446875 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N,N'-bis(2-methylphenyl)-2-[(5-methylthiophen-2-yl)methylidene]propanediamide |
| SMILES | Cc1ccc(C=C(C(=O)Nc2ccccc2C)C(=O)Nc2ccccc2C)s1 |
| InChI | InChI=1S/C23H22N2O2S/c1-15-8-4-6-10-20(15)24-22(26)19(14-18-13-12-17(3)28-18)23(27)25-21-11-7-5-9-16(21)2/h4-14H,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | FRXGTYYJWXDZKA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|