C14H15NOS — CID 7733041
N-(2,3-dimethylphenyl)-5-methylthiophene-2-carboxamide (PubChem CID 7733041) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 7733041 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-(2,3-dimethylphenyl)-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C)c2C)s1 |
| InChI | InChI=1S/C14H15NOS/c1-9-5-4-6-12(11(9)3)15-14(16)13-8-7-10(2)17-13/h4-8H,1-3H3,(H,15,16) |
| InChIKey | PYKUIMCENHCPRS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |