C21H28 — CID 142235568
[(6E,8Z)-6-ethenyl-4-propyldeca-4,6,8-trien-5-yl]benzene (PubChem CID 142235568) has the molecular formula C21H28 and a molecular weight of 280.46 g/mol. Its IUPAC name is [(6E,8Z)-6-ethenyl-4-propyldeca-4,6,8-trien-5-yl]benzene.
| Compound Name | [(6E,8Z)-6-ethenyl-4-propyldeca-4,6,8-trien-5-yl]benzene |
|---|---|
| PubChem CID | 142235568 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | [(6E,8Z)-6-ethenyl-4-propyldeca-4,6,8-trien-5-yl]benzene |
| SMILES | C=C/C(=C\C=C/C)C(=C(CCC)CCC)c1ccccc1 |
| InChI | InChI=1S/C21H28/c1-5-9-15-18(8-4)21(19(13-6-2)14-7-3)20-16-11-10-12-17-20/h5,8-12,15-17H,4,6-7,13-14H2,1-3H3/b9-5-,18-15+ |
| InChIKey | OTLQOHOGXHIWKB-SPLVJYBBSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|