C23H21ClO2S — CID 22302571
S-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl] (2E,4E)-2-ethenylhexa-2,4-dienethioate (PubChem CID 22302571) has the molecular formula C23H21ClO2S and a molecular weight of 396.94 g/mol. Its IUPAC name is S-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl] (2E,4E)-2-ethenylhexa-2,4-dienethioate.
| Compound Name | S-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl] (2E,4E)-2-ethenylhexa-2,4-dienethioate |
|---|---|
| PubChem CID | 22302571 |
| Molecular Formula | C23H21ClO2S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | S-[1-(4-chlorophenyl)-3-oxo-3-phenylpropyl] (2E,4E)-2-ethenylhexa-2,4-dienethioate |
| SMILES | C=C/C(=C\C=C\C)C(=O)SC(CC(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClO2S/c1-3-5-9-17(4-2)23(26)27-22(19-12-14-20(24)15-13-19)16-21(25)18-10-7-6-8-11-18/h3-15,22H,2,16H2,1H3/b5-3+,17-9+ |
| InChIKey | QXEKWLSMHHIOLD-AHEHSYJASA-N |
| XLogP | 6.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|