C18H18OS — CID 11514699
1,3-diphenyl-3-prop-2-enylsulfanylpropan-1-one (PubChem CID 11514699) has the molecular formula C18H18OS and a molecular weight of 282.41 g/mol. Its IUPAC name is 1,3-diphenyl-3-prop-2-enylsulfanylpropan-1-one.
| Compound Name | 1,3-diphenyl-3-prop-2-enylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 11514699 |
| Molecular Formula | C18H18OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1,3-diphenyl-3-prop-2-enylsulfanylpropan-1-one |
| SMILES | C=CCSC(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18OS/c1-2-13-20-18(16-11-7-4-8-12-16)14-17(19)15-9-5-3-6-10-15/h2-12,18H,1,13-14H2 |
| InChIKey | HEUZAWNNFUVXLY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|