C18H18O — CID 11288162
(3S)-1,3-diphenylhex-5-en-1-one (PubChem CID 11288162) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is (3S)-1,3-diphenylhex-5-en-1-one.
| Compound Name | (3S)-1,3-diphenylhex-5-en-1-one |
|---|---|
| PubChem CID | 11288162 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (3S)-1,3-diphenylhex-5-en-1-one |
| SMILES | C=CC[C@@H](CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18O/c1-2-9-17(15-10-5-3-6-11-15)14-18(19)16-12-7-4-8-13-16/h2-8,10-13,17H,1,9,14H2/t17-/m0/s1 |
| InChIKey | ABCONMWWENQPNG-KRWDZBQOSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|