C19H18O3 — CID 71390061
7-oxo-5,7-diphenylhept-2-enoic acid (PubChem CID 71390061) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 7-oxo-5,7-diphenylhept-2-enoic acid.
| Compound Name | 7-oxo-5,7-diphenylhept-2-enoic acid |
|---|---|
| PubChem CID | 71390061 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 7-oxo-5,7-diphenylhept-2-enoic acid |
| SMILES | O=C(O)C=CCC(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O3/c20-18(16-10-5-2-6-11-16)14-17(12-7-13-19(21)22)15-8-3-1-4-9-15/h1-11,13,17H,12,14H2,(H,21,22) |
| InChIKey | MJSVXQZXAIBFJI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|