C27H26O — CID 101258032
(3R)-7-methyl-1,3,5-triphenylocta-5,6-dien-1-one (PubChem CID 101258032) has the molecular formula C27H26O and a molecular weight of 366.50 g/mol. Its IUPAC name is (3R)-7-methyl-1,3,5-triphenylocta-5,6-dien-1-one.
| Compound Name | (3R)-7-methyl-1,3,5-triphenylocta-5,6-dien-1-one |
|---|---|
| PubChem CID | 101258032 |
| Molecular Formula | C27H26O |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (3R)-7-methyl-1,3,5-triphenylocta-5,6-dien-1-one |
| SMILES | CC(C)=C=C(C[C@H](CC(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26O/c1-21(2)18-25(22-12-6-3-7-13-22)19-26(23-14-8-4-9-15-23)20-27(28)24-16-10-5-11-17-24/h3-17,26H,19-20H2,1-2H3/t26-/m1/s1 |
| InChIKey | GGTMJHQHOCQVOX-AREMUKBSSA-N |
| XLogP | 7.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |