C25H24O4 — CID 10318087
[(1R)-2-hydroxy-1-phenylethyl] (3S)-5-oxo-3,5-diphenylpentanoate (PubChem CID 10318087) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is [(1R)-2-hydroxy-1-phenylethyl] (3S)-5-oxo-3,5-diphenylpentanoate.
| Compound Name | [(1R)-2-hydroxy-1-phenylethyl] (3S)-5-oxo-3,5-diphenylpentanoate |
|---|---|
| PubChem CID | 10318087 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [(1R)-2-hydroxy-1-phenylethyl] (3S)-5-oxo-3,5-diphenylpentanoate |
| SMILES | O=C(C[C@H](CC(=O)c1ccccc1)c1ccccc1)O[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C25H24O4/c26-18-24(21-14-8-3-9-15-21)29-25(28)17-22(19-10-4-1-5-11-19)16-23(27)20-12-6-2-7-13-20/h1-15,22,24,26H,16-18H2/t22-,24-/m0/s1 |
| InChIKey | RJZHPNPOARQBKK-UPVQGACJSA-N |
| XLogP | 4.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |