C52H58B2 — CID 177024832
CID 177024832 (PubChem CID 177024832) has the molecular formula C52H58B2 and a molecular weight of 704.66 g/mol.
| Compound Name | CID 177024832 |
|---|---|
| PubChem CID | 177024832 |
| Molecular Formula | C52H58B2 |
| Molecular Weight | 704.66 g/mol |
| Exact Mass | 704.47 |
| IUPAC Name | — |
| SMILES | C=CC(=C\C=C/C)/C(C)=C(C(/[B][B]C(/C(=C(C)/C(C=C)=C/C=C\C)c1ccccc1)=C(C)\C(C=C)=C\C=C/C)=C(C)/C(C=C)=C/C=C\C)\c1ccccc1 |
| InChI | InChI=1S/C52H58B2/c1-13-21-31-43(17-5)39(9)49(47-35-27-25-28-36-47)51(41(11)45(19-7)33-23-15-3)53-54-52(42(12)46(20-8)34-24-16-4)50(48-37-29-26-30-38-48)40(10)44(18-6)32-22-14-2/h13-38H,5-8H2,1-4,9-12H3/b21-13-,22-14-,23-15-,24-16-,43-31+,44-32+,45-33+,46-34+,49-39+,50-40+,51-41-,52-42- |
| InChIKey | NANBTKGRFNMEOK-WSTKAFAPSA-N |
| XLogP | 14.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.66 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|