C32H29B — CID 173478367
[(1Z,3E,5Z)-3-methyl-1,2-diphenylhepta-1,3,5-trienyl]-diphenylborane (PubChem CID 173478367) has the molecular formula C32H29B and a molecular weight of 424.40 g/mol. Its IUPAC name is [(1Z,3E,5Z)-3-methyl-1,2-diphenylhepta-1,3,5-trienyl]-diphenylborane.
| Compound Name | [(1Z,3E,5Z)-3-methyl-1,2-diphenylhepta-1,3,5-trienyl]-diphenylborane |
|---|---|
| PubChem CID | 173478367 |
| Molecular Formula | C32H29B |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [(1Z,3E,5Z)-3-methyl-1,2-diphenylhepta-1,3,5-trienyl]-diphenylborane |
| SMILES | C/C=C\C=C(C)\C(=C(/B(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29B/c1-3-4-17-26(2)31(27-18-9-5-10-19-27)32(28-20-11-6-12-21-28)33(29-22-13-7-14-23-29)30-24-15-8-16-25-30/h3-25H,1-2H3/b4-3-,26-17+,32-31+ |
| InChIKey | SCBFQLYURFPVHC-URQFJJAOSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|