C27H31BSi — CID 134903758
[(1E)-1-diphenylboranyl-3-methyl-1-phenylbuta-1,3-dien-2-yl]-ethyl-dimethylsilane (PubChem CID 134903758) has the molecular formula C27H31BSi and a molecular weight of 394.44 g/mol. Its IUPAC name is [(1E)-1-diphenylboranyl-3-methyl-1-phenylbuta-1,3-dien-2-yl]-ethyl-dimethylsilane.
| Compound Name | [(1E)-1-diphenylboranyl-3-methyl-1-phenylbuta-1,3-dien-2-yl]-ethyl-dimethylsilane |
|---|---|
| PubChem CID | 134903758 |
| Molecular Formula | C27H31BSi |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [(1E)-1-diphenylboranyl-3-methyl-1-phenylbuta-1,3-dien-2-yl]-ethyl-dimethylsilane |
| SMILES | C=C(C)/C(=C(/B(c1ccccc1)c1ccccc1)c1ccccc1)[Si](C)(C)CC |
| InChI | InChI=1S/C27H31BSi/c1-6-29(4,5)27(22(2)3)26(23-16-10-7-11-17-23)28(24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21H,2,6H2,1,3-5H3/b27-26- |
| InChIKey | WLRWKZXXEPJFBF-RQZHXJHFSA-N |
| XLogP | 6.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|